C10H14O4 — CID 141140439
1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,2-dione (PubChem CID 141140439) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,2-dione.
| Compound Name | 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,2-dione |
|---|---|
| PubChem CID | 141140439 |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.22 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 1-[(4S,5S)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propane-1,2-dione |
| SMILES | C=C[C@@H]1OC(C)(C)O[C@@H]1C(=O)C(C)=O |
| InChI | InChI=1S/C10H14O4/c1-5-7-9(8(12)6(2)11)14-10(3,4)13-7/h5,7,9H,1H2,2-4H3/t7-,9-/m0/s1 |
| InChIKey | MIXYUVFATIIBGR-CBAPKCEASA-N |
| XLogP | 0.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.22 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|