C19H23BrN2O — CID 108901615
1-[2-(3-bromophenyl)ethyl]-3-[1-(4-ethylphenyl)ethyl]urea (PubChem CID 108901615) has the molecular formula C19H23BrN2O and a molecular weight of 375.31 g/mol. Its IUPAC name is 1-[2-(3-bromophenyl)ethyl]-3-[1-(4-ethylphenyl)ethyl]urea.
| Compound Name | 1-[2-(3-bromophenyl)ethyl]-3-[1-(4-ethylphenyl)ethyl]urea |
|---|---|
| PubChem CID | 108901615 |
| Molecular Formula | C19H23BrN2O |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 1-[2-(3-bromophenyl)ethyl]-3-[1-(4-ethylphenyl)ethyl]urea |
| SMILES | CCc1ccc(C(C)NC(=O)NCCc2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C19H23BrN2O/c1-3-15-7-9-17(10-8-15)14(2)22-19(23)21-12-11-16-5-4-6-18(20)13-16/h4-10,13-14H,3,11-12H2,1-2H3,(H2,21,22,23) |
| InChIKey | AZROLZUTEWPJGN-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |