C13H18BrN3O4 — CID 88903963
(2R,3S)-2-[2-(3-bromophenyl)ethylcarbamoylamino]-N,3-dihydroxybutanamide (PubChem CID 88903963) has the molecular formula C13H18BrN3O4 and a molecular weight of 360.21 g/mol. Its IUPAC name is (2R,3S)-2-[2-(3-bromophenyl)ethylcarbamoylamino]-N,3-dihydroxybutanamide.
| Compound Name | (2R,3S)-2-[2-(3-bromophenyl)ethylcarbamoylamino]-N,3-dihydroxybutanamide |
|---|---|
| PubChem CID | 88903963 |
| Molecular Formula | C13H18BrN3O4 |
| Molecular Weight | 360.21 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | (2R,3S)-2-[2-(3-bromophenyl)ethylcarbamoylamino]-N,3-dihydroxybutanamide |
| SMILES | C[C@H](O)[C@@H](NC(=O)NCCc1cccc(Br)c1)C(=O)NO |
| InChI | InChI=1S/C13H18BrN3O4/c1-8(18)11(12(19)17-21)16-13(20)15-6-5-9-3-2-4-10(14)7-9/h2-4,7-8,11,18,21H,5-6H2,1H3,(H,17,19)(H2,15,16,20)/t8-,11+/m0/s1 |
| InChIKey | QYOQVVZCKYBNFB-GZMMTYOYSA-N |
| XLogP | 0.55 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|