C22H24N2O4 — CID 58412822
1-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-3-[2-[3-(2-phenylethynyl)phenyl]ethyl]urea (PubChem CID 58412822) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-3-[2-[3-(2-phenylethynyl)phenyl]ethyl]urea.
| Compound Name | 1-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-3-[2-[3-(2-phenylethynyl)phenyl]ethyl]urea |
|---|---|
| PubChem CID | 58412822 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | 1-[(3S,4R)-1,4-dihydroxy-2-oxopentan-3-yl]-3-[2-[3-(2-phenylethynyl)phenyl]ethyl]urea |
| SMILES | C[C@@H](O)[C@H](NC(=O)NCCc1cccc(C#Cc2ccccc2)c1)C(=O)CO |
| InChI | InChI=1S/C22H24N2O4/c1-16(26)21(20(27)15-25)24-22(28)23-13-12-19-9-5-8-18(14-19)11-10-17-6-3-2-4-7-17/h2-9,14,16,21,25-26H,12-13,15H2,1H3,(H2,23,24,28)/t16-,21+/m1/s1 |
| InChIKey | VXLMDGFZNYCSFS-IERDGZPVSA-N |
| XLogP | 1.24 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|