C16H21ClN2O — CID 108904598
3-[(E)-2-(2-chlorophenyl)ethenyl]-1-cyclohexyl-1-methylurea (PubChem CID 108904598) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 3-[(E)-2-(2-chlorophenyl)ethenyl]-1-cyclohexyl-1-methylurea.
| Compound Name | 3-[(E)-2-(2-chlorophenyl)ethenyl]-1-cyclohexyl-1-methylurea |
|---|---|
| PubChem CID | 108904598 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 3-[(E)-2-(2-chlorophenyl)ethenyl]-1-cyclohexyl-1-methylurea |
| SMILES | CN(C(=O)N/C=C/c1ccccc1Cl)C1CCCCC1 |
| InChI | InChI=1S/C16H21ClN2O/c1-19(14-8-3-2-4-9-14)16(20)18-12-11-13-7-5-6-10-15(13)17/h5-7,10-12,14H,2-4,8-9H2,1H3,(H,18,20)/b12-11+ |
| InChIKey | HZLVXIIWGVVWNM-VAWYXSNFSA-N |
| XLogP | 4.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |