C12H10ClN3OS — CID 108904701
1-[(E)-2-(2-chlorophenyl)ethenyl]-3-(1,3-thiazol-2-yl)urea (PubChem CID 108904701) has the molecular formula C12H10ClN3OS and a molecular weight of 279.75 g/mol. Its IUPAC name is 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 108904701 |
| Molecular Formula | C12H10ClN3OS |
| Molecular Weight | 279.75 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-[(E)-2-(2-chlorophenyl)ethenyl]-3-(1,3-thiazol-2-yl)urea |
| SMILES | O=C(N/C=C/c1ccccc1Cl)Nc1nccs1 |
| InChI | InChI=1S/C12H10ClN3OS/c13-10-4-2-1-3-9(10)5-6-14-11(17)16-12-15-7-8-18-12/h1-8H,(H2,14,15,16,17)/b6-5+ |
| InChIKey | YCNYPFWCVKOMRC-AATRIKPKSA-N |
| XLogP | 3.59 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.75 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |