C18H18ClN3O3 — CID 108906730
N-[(E)-2-(3-chlorophenyl)ethenyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide (PubChem CID 108906730) has the molecular formula C18H18ClN3O3 and a molecular weight of 359.81 g/mol. Its IUPAC name is N-[(E)-2-(3-chlorophenyl)ethenyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide.
| Compound Name | N-[(E)-2-(3-chlorophenyl)ethenyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108906730 |
| Molecular Formula | C18H18ClN3O3 |
| Molecular Weight | 359.81 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[(E)-2-(3-chlorophenyl)ethenyl]-4-(furan-2-carbonyl)piperazine-1-carboxamide |
| SMILES | O=C(N/C=C/c1cccc(Cl)c1)N1CCN(C(=O)c2ccco2)CC1 |
| InChI | InChI=1S/C18H18ClN3O3/c19-15-4-1-3-14(13-15)6-7-20-18(24)22-10-8-21(9-11-22)17(23)16-5-2-12-25-16/h1-7,12-13H,8-11H2,(H,20,24)/b7-6+ |
| InChIKey | BOEWKQFNKFZCOS-VOTSOKGWSA-N |
| XLogP | 3.07 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |