C13H17ClN2O3 — CID 108908518
1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2,2-dimethoxyethyl)urea (PubChem CID 108908518) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2,2-dimethoxyethyl)urea.
| Compound Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2,2-dimethoxyethyl)urea |
|---|---|
| PubChem CID | 108908518 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 1-[(E)-2-(4-chlorophenyl)ethenyl]-3-(2,2-dimethoxyethyl)urea |
| SMILES | COC(CNC(=O)N/C=C/c1ccc(Cl)cc1)OC |
| InChI | InChI=1S/C13H17ClN2O3/c1-18-12(19-2)9-16-13(17)15-8-7-10-3-5-11(14)6-4-10/h3-8,12H,9H2,1-2H3,(H2,15,16,17)/b8-7+ |
| InChIKey | FQPBKGPFYIQVOS-BQYQJAHWSA-N |
| XLogP | 2.23 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|