C11H22N2O3 — CID 108911482
1-(2,2-dimethoxyethyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea (PubChem CID 108911482) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-(2,2-dimethoxyethyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911482 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
| SMILES | COC(CNC(=O)N/C=C/C(C)(C)C)OC |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)6-7-12-10(14)13-8-9(15-4)16-5/h6-7,9H,8H2,1-5H3,(H2,12,13,14)/b7-6+ |
| InChIKey | PPSVFCVTAXZBGT-VOTSOKGWSA-N |
| XLogP | 1.46 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|