C11H12F2N2O — CID 108909916
1-(2,6-difluorophenyl)-3-(2-methylprop-1-enyl)urea (PubChem CID 108909916) has the molecular formula C11H12F2N2O and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(2-methylprop-1-enyl)urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-(2-methylprop-1-enyl)urea |
|---|---|
| PubChem CID | 108909916 |
| Molecular Formula | C11H12F2N2O |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(2-methylprop-1-enyl)urea |
| SMILES | CC(C)=CNC(=O)Nc1c(F)cccc1F |
| InChI | InChI=1S/C11H12F2N2O/c1-7(2)6-14-11(16)15-10-8(12)4-3-5-9(10)13/h3-6H,1-2H3,(H2,14,15,16) |
| InChIKey | SPDVDCUTDBZTKT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |