C19H17NO6 — CID 1089104
(5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 1089104) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 1089104 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | (5R)-5-(4-hydroxy-3-methoxyphenyl)-4-[hydroxy-(3-methoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1cccc(C(O)=C2C(=O)C(=O)N[C@@H]2c2ccc(O)c(OC)c2)c1 |
| InChI | InChI=1S/C19H17NO6/c1-25-12-5-3-4-11(8-12)17(22)15-16(20-19(24)18(15)23)10-6-7-13(21)14(9-10)26-2/h3-9,16,21-22H,1-2H3,(H,20,24)/t16-/m1/s1 |
| InChIKey | XVGKAFBICYWHQT-MRXNPFEDSA-N |
| XLogP | 2.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|