C9H18N2O2 — CID 108910553
1-[(E)-but-1-enyl]-3-(3-methoxypropyl)urea (PubChem CID 108910553) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 1-[(E)-but-1-enyl]-3-(3-methoxypropyl)urea.
| Compound Name | 1-[(E)-but-1-enyl]-3-(3-methoxypropyl)urea |
|---|---|
| PubChem CID | 108910553 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 1-[(E)-but-1-enyl]-3-(3-methoxypropyl)urea |
| SMILES | CC/C=C/NC(=O)NCCCOC |
| InChI | InChI=1S/C9H18N2O2/c1-3-4-6-10-9(12)11-7-5-8-13-2/h4,6H,3,5,7-8H2,1-2H3,(H2,10,11,12)/b6-4+ |
| InChIKey | HVOUXDJRGYPLJX-GQCTYLIASA-N |
| XLogP | 1.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|