C8H15ClN2O — CID 108910974
1-(2-chloroethyl)-3-[(E)-3-methylbut-1-enyl]urea (PubChem CID 108910974) has the molecular formula C8H15ClN2O and a molecular weight of 190.67 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(E)-3-methylbut-1-enyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[(E)-3-methylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108910974 |
| Molecular Formula | C8H15ClN2O |
| Molecular Weight | 190.67 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(E)-3-methylbut-1-enyl]urea |
| SMILES | CC(C)/C=C/NC(=O)NCCCl |
| InChI | InChI=1S/C8H15ClN2O/c1-7(2)3-5-10-8(12)11-6-4-9/h3,5,7H,4,6H2,1-2H3,(H2,10,11,12)/b5-3+ |
| InChIKey | NDVHVBYUOMONLR-HWKANZROSA-N |
| XLogP | 1.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.67 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|