C9H15ClN2O — CID 108915767
1-(3-chloropropyl)-3-[(E)-2-cyclopropylethenyl]urea (PubChem CID 108915767) has the molecular formula C9H15ClN2O and a molecular weight of 202.68 g/mol. Its IUPAC name is 1-(3-chloropropyl)-3-[(E)-2-cyclopropylethenyl]urea.
| Compound Name | 1-(3-chloropropyl)-3-[(E)-2-cyclopropylethenyl]urea |
|---|---|
| PubChem CID | 108915767 |
| Molecular Formula | C9H15ClN2O |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 1-(3-chloropropyl)-3-[(E)-2-cyclopropylethenyl]urea |
| SMILES | O=C(N/C=C/C1CC1)NCCCCl |
| InChI | InChI=1S/C9H15ClN2O/c10-5-1-6-11-9(13)12-7-4-8-2-3-8/h4,7-8H,1-3,5-6H2,(H2,11,12,13)/b7-4+ |
| InChIKey | ZSIGDPKXBKBBTF-QPJJXVBHSA-N |
| XLogP | 1.84 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|