C9H16N2O2 — CID 108915818
1-[(E)-2-cyclopropylethenyl]-3-(2-hydroxypropyl)urea (PubChem CID 108915818) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-[(E)-2-cyclopropylethenyl]-3-(2-hydroxypropyl)urea.
| Compound Name | 1-[(E)-2-cyclopropylethenyl]-3-(2-hydroxypropyl)urea |
|---|---|
| PubChem CID | 108915818 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-[(E)-2-cyclopropylethenyl]-3-(2-hydroxypropyl)urea |
| SMILES | CC(O)CNC(=O)N/C=C/C1CC1 |
| InChI | InChI=1S/C9H16N2O2/c1-7(12)6-11-9(13)10-5-4-8-2-3-8/h4-5,7-8,12H,2-3,6H2,1H3,(H2,10,11,13)/b5-4+ |
| InChIKey | PUSNAKYYXAHOFZ-SNAWJCMRSA-N |
| XLogP | 0.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |