About 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea
3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea (PubChem CID 108915860) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea.
Molecular Properties
| Compound Name | 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea |
| PubChem CID | 108915860 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N/C=C/C1CC1 |
| InChI | InChI=1S/C10H18N2O/c1-3-12(4-2)10(13)11-8-7-9-5-6-9/h7-9H,3-6H2,1-2H3,(H,11,13)/b8-7+ |
| InChIKey | XVWKLGPSGIBUBV-BQYQJAHWSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea?
The IUPAC name of 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea (CID 108915860) is 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea.
What is the SMILES notation for 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea?
The canonical SMILES for 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea is CCN(CC)C(=O)N/C=C/C1CC1.
What is the InChIKey of 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea?
The InChIKey is XVWKLGPSGIBUBV-BQYQJAHWSA-N. The full InChI is InChI=1S/C10H18N2O/c1-3-12(4-2)10(13)11-8-7-9-5-6-9/h7-9H,3-6H2,1-2H3,(H,11,13)/b8-7+.
What are the key properties of 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea?
3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea has a molecular weight of 182.27 g/mol, XLogP of 1.96, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea is sourced from PubChem (CID 108915860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).