C10H18N2O — CID 108915860
3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea (PubChem CID 108915860) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea.
| Compound Name | 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea |
|---|---|
| PubChem CID | 108915860 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 3-[(E)-2-cyclopropylethenyl]-1,1-diethylurea |
| SMILES | CCN(CC)C(=O)N/C=C/C1CC1 |
| InChI | InChI=1S/C10H18N2O/c1-3-12(4-2)10(13)11-8-7-9-5-6-9/h7-9H,3-6H2,1-2H3,(H,11,13)/b8-7+ |
| InChIKey | XVWKLGPSGIBUBV-BQYQJAHWSA-N |
| XLogP | 1.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |