C15H20N2O — CID 108915759
1-[(E)-2-cyclopropylethenyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 108915759) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 1-[(E)-2-cyclopropylethenyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[(E)-2-cyclopropylethenyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 108915759 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 1-[(E)-2-cyclopropylethenyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)N/C=C/C2CC2)c(C)c1 |
| InChI | InChI=1S/C15H20N2O/c1-10-8-11(2)14(12(3)9-10)17-15(18)16-7-6-13-4-5-13/h6-9,13H,4-5H2,1-3H3,(H2,16,17,18)/b7-6+ |
| InChIKey | VWCYXPLANCHVEQ-VOTSOKGWSA-N |
| XLogP | 3.66 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |