C11H19ClN2O — CID 108913903
1-(2-chloroethyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea (PubChem CID 108913903) has the molecular formula C11H19ClN2O and a molecular weight of 230.74 g/mol. Its IUPAC name is 1-(2-chloroethyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea.
| Compound Name | 1-(2-chloroethyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea |
|---|---|
| PubChem CID | 108913903 |
| Molecular Formula | C11H19ClN2O |
| Molecular Weight | 230.74 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 1-(2-chloroethyl)-3-[(E)-2-cyclopentylprop-1-enyl]urea |
| SMILES | C/C(=C\NC(=O)NCCCl)C1CCCC1 |
| InChI | InChI=1S/C11H19ClN2O/c1-9(10-4-2-3-5-10)8-14-11(15)13-7-6-12/h8,10H,2-7H2,1H3,(H2,13,14,15)/b9-8+ |
| InChIKey | VFCOLABITQMHMM-CMDGGOBGSA-N |
| XLogP | 2.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.74 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|