C11H18N2O3 — CID 108915612
methyl 3-[[(E)-2-cyclopropylprop-1-enyl]carbamoylamino]propanoate (PubChem CID 108915612) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is methyl 3-[[(E)-2-cyclopropylprop-1-enyl]carbamoylamino]propanoate.
| Compound Name | methyl 3-[[(E)-2-cyclopropylprop-1-enyl]carbamoylamino]propanoate |
|---|---|
| PubChem CID | 108915612 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | methyl 3-[[(E)-2-cyclopropylprop-1-enyl]carbamoylamino]propanoate |
| SMILES | COC(=O)CCNC(=O)N/C=C(\C)C1CC1 |
| InChI | InChI=1S/C11H18N2O3/c1-8(9-3-4-9)7-13-11(15)12-6-5-10(14)16-2/h7,9H,3-6H2,1-2H3,(H2,12,13,15)/b8-7+ |
| InChIKey | YXSVRZMSSQIIKM-BQYQJAHWSA-N |
| XLogP | 1.16 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |