C15H23N3O — CID 108911457
1-[4-(dimethylamino)phenyl]-3-[(E)-3,3-dimethylbut-1-enyl]urea (PubChem CID 108911457) has the molecular formula C15H23N3O and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[4-(dimethylamino)phenyl]-3-[(E)-3,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-[4-(dimethylamino)phenyl]-3-[(E)-3,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911457 |
| Molecular Formula | C15H23N3O |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.18 |
| IUPAC Name | 1-[4-(dimethylamino)phenyl]-3-[(E)-3,3-dimethylbut-1-enyl]urea |
| SMILES | CN(C)c1ccc(NC(=O)N/C=C/C(C)(C)C)cc1 |
| InChI | InChI=1S/C15H23N3O/c1-15(2,3)10-11-16-14(19)17-12-6-8-13(9-7-12)18(4)5/h6-11H,1-5H3,(H2,16,17,19)/b11-10+ |
| InChIKey | DUGGYMYQKZSDEI-ZHACJKMWSA-N |
| XLogP | 3.43 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|