C13H16Cl2N2O — CID 108911530
1-(2,6-dichlorophenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea (PubChem CID 108911530) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 1-(2,6-dichlorophenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-(2,6-dichlorophenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911530 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 1-(2,6-dichlorophenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
| SMILES | CC(C)(C)/C=C/NC(=O)Nc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H16Cl2N2O/c1-13(2,3)7-8-16-12(18)17-11-9(14)5-4-6-10(11)15/h4-8H,1-3H3,(H2,16,17,18)/b8-7+ |
| InChIKey | WBBWJRLKKIIRQT-BQYQJAHWSA-N |
| XLogP | 4.67 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |