C17H26N2O — CID 108911333
1-(2,6-diethylphenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea (PubChem CID 108911333) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108911333 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[(E)-3,3-dimethylbut-1-enyl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)N/C=C/C(C)(C)C |
| InChI | InChI=1S/C17H26N2O/c1-6-13-9-8-10-14(7-2)15(13)19-16(20)18-12-11-17(3,4)5/h8-12H,6-7H2,1-5H3,(H2,18,19,20)/b12-11+ |
| InChIKey | BPDJZOZNNOLKTQ-VAWYXSNFSA-N |
| XLogP | 4.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |