C13H23N3O2 — CID 108911524
1-N-[(E)-3,3-dimethylbut-1-enyl]piperidine-1,4-dicarboxamide (PubChem CID 108911524) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-N-[(E)-3,3-dimethylbut-1-enyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(E)-3,3-dimethylbut-1-enyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 108911524 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-N-[(E)-3,3-dimethylbut-1-enyl]piperidine-1,4-dicarboxamide |
| SMILES | CC(C)(C)/C=C/NC(=O)N1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C13H23N3O2/c1-13(2,3)6-7-15-12(18)16-8-4-10(5-9-16)11(14)17/h6-7,10H,4-5,8-9H2,1-3H3,(H2,14,17)(H,15,18)/b7-6+ |
| InChIKey | HCRHANUSXKCPSL-VOTSOKGWSA-N |
| XLogP | 1.45 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |