C19H27N3O — CID 108911886
N-[(E)-2-cyclopentylethenyl]-4-(3-methylphenyl)piperazine-1-carboxamide (PubChem CID 108911886) has the molecular formula C19H27N3O and a molecular weight of 313.44 g/mol. Its IUPAC name is N-[(E)-2-cyclopentylethenyl]-4-(3-methylphenyl)piperazine-1-carboxamide.
| Compound Name | N-[(E)-2-cyclopentylethenyl]-4-(3-methylphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108911886 |
| Molecular Formula | C19H27N3O |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.22 |
| IUPAC Name | N-[(E)-2-cyclopentylethenyl]-4-(3-methylphenyl)piperazine-1-carboxamide |
| SMILES | Cc1cccc(N2CCN(C(=O)N/C=C/C3CCCC3)CC2)c1 |
| InChI | InChI=1S/C19H27N3O/c1-16-5-4-8-18(15-16)21-11-13-22(14-12-21)19(23)20-10-9-17-6-2-3-7-17/h4-5,8-10,15,17H,2-3,6-7,11-14H2,1H3,(H,20,23)/b10-9+ |
| InChIKey | TVKHVSALWNMVBE-MDZDMXLPSA-N |
| XLogP | 3.53 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |