C10H18N2O2 — CID 108913090
1-(oxan-4-ylidenemethyl)-3-propan-2-ylurea (PubChem CID 108913090) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 1-(oxan-4-ylidenemethyl)-3-propan-2-ylurea.
| Compound Name | 1-(oxan-4-ylidenemethyl)-3-propan-2-ylurea |
|---|---|
| PubChem CID | 108913090 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-(oxan-4-ylidenemethyl)-3-propan-2-ylurea |
| SMILES | CC(C)NC(=O)NC=C1CCOCC1 |
| InChI | InChI=1S/C10H18N2O2/c1-8(2)12-10(13)11-7-9-3-5-14-6-4-9/h7-8H,3-6H2,1-2H3,(H2,11,12,13) |
| InChIKey | GRHFMELKLWXLEE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |