C15H20N2O4 — CID 108913229
1-(2,4-dimethoxyphenyl)-3-(oxan-4-ylidenemethyl)urea (PubChem CID 108913229) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-3-(oxan-4-ylidenemethyl)urea.
| Compound Name | 1-(2,4-dimethoxyphenyl)-3-(oxan-4-ylidenemethyl)urea |
|---|---|
| PubChem CID | 108913229 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-3-(oxan-4-ylidenemethyl)urea |
| SMILES | COc1ccc(NC(=O)NC=C2CCOCC2)c(OC)c1 |
| InChI | InChI=1S/C15H20N2O4/c1-19-12-3-4-13(14(9-12)20-2)17-15(18)16-10-11-5-7-21-8-6-11/h3-4,9-10H,5-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | UGMORKIQDXUGCQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |