C13H17ClN2O2 — CID 108914204
1-(5-chloro-2-methoxyphenyl)-3-[(E)-2-methylbut-1-enyl]urea (PubChem CID 108914204) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[(E)-2-methylbut-1-enyl]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[(E)-2-methylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108914204 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[(E)-2-methylbut-1-enyl]urea |
| SMILES | CC/C(C)=C/NC(=O)Nc1cc(Cl)ccc1OC |
| InChI | InChI=1S/C13H17ClN2O2/c1-4-9(2)8-15-13(17)16-11-7-10(14)5-6-12(11)18-3/h5-8H,4H2,1-3H3,(H2,15,16,17)/b9-8+ |
| InChIKey | YIZMDOOBWTVCCG-CMDGGOBGSA-N |
| XLogP | 3.78 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |