C14H22O6 — CID 10891457
(2Z)-2-[(3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]ethanol (PubChem CID 10891457) has the molecular formula C14H22O6 and a molecular weight of 286.32 g/mol. Its IUPAC name is (2Z)-2-[(3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]ethanol.
| Compound Name | (2Z)-2-[(3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]ethanol |
|---|---|
| PubChem CID | 10891457 |
| Molecular Formula | C14H22O6 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | (2Z)-2-[(3aR,5S,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,6a-dihydrofuro[2,3-d][1,3]dioxol-6-ylidene]ethanol |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(C)(C)O3)/C(=C/CO)[C@H]2O1 |
| InChI | InChI=1S/C14H22O6/c1-13(2)16-7-9(18-13)10-8(5-6-15)11-12(17-10)20-14(3,4)19-11/h5,9-12,15H,6-7H2,1-4H3/b8-5-/t9-,10+,11-,12-/m1/s1 |
| InChIKey | CVTVIDAYOLRPSW-PSMWUYFOSA-N |
| XLogP | 0.93 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|