C13H18O7 — CID 135011326
3-[(S)-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-hydroxymethyl]-2H-furan-5-one (PubChem CID 135011326) has the molecular formula C13H18O7 and a molecular weight of 286.28 g/mol. Its IUPAC name is 3-[(S)-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-hydroxymethyl]-2H-furan-5-one.
| Compound Name | 3-[(S)-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-hydroxymethyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 135011326 |
| Molecular Formula | C13H18O7 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3-[(S)-[(3aS,4S,6R,6aS)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-hydroxymethyl]-2H-furan-5-one |
| SMILES | CO[C@H]1O[C@H]([C@@H](O)C2=CC(=O)OC2)[C@@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C13H18O7/c1-13(2)19-10-9(18-12(16-3)11(10)20-13)8(15)6-4-7(14)17-5-6/h4,8-12,15H,5H2,1-3H3/t8-,9+,10-,11-,12-/m0/s1 |
| InChIKey | VTORGIOOBGMHQK-OSUNSFLBSA-N |
| XLogP | -0.28 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |