C12H14O7 — CID 135011362
(1S,2R,6R,8R,9S,10R)-9-hydroxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one (PubChem CID 135011362) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is (1S,2R,6R,8R,9S,10R)-9-hydroxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one.
| Compound Name | (1S,2R,6R,8R,9S,10R)-9-hydroxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one |
|---|---|
| PubChem CID | 135011362 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (1S,2R,6R,8R,9S,10R)-9-hydroxy-4,4-dimethylspiro[3,5,7,11-tetraoxatricyclo[6.3.0.02,6]undecane-10,5'-furan]-2'-one |
| SMILES | CC1(C)O[C@H]2O[C@H]3[C@H](O[C@@]4(C=CC(=O)O4)[C@H]3O)[C@H]2O1 |
| InChI | InChI=1S/C12H14O7/c1-11(2)17-8-6-7(15-10(8)19-11)9(14)12(18-6)4-3-5(13)16-12/h3-4,6-10,14H,1-2H3/t6-,7-,8+,9-,10+,12-/m0/s1 |
| InChIKey | DVDHDDQJYLQXIH-ZIYHLNCNSA-N |
| XLogP | -0.57 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |