C11H22N2O3 — CID 108914622
3-[(E)-2,3-dimethylbut-1-enyl]-1,1-bis(2-hydroxyethyl)urea (PubChem CID 108914622) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-[(E)-2,3-dimethylbut-1-enyl]-1,1-bis(2-hydroxyethyl)urea.
| Compound Name | 3-[(E)-2,3-dimethylbut-1-enyl]-1,1-bis(2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 108914622 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 3-[(E)-2,3-dimethylbut-1-enyl]-1,1-bis(2-hydroxyethyl)urea |
| SMILES | C/C(=C\NC(=O)N(CCO)CCO)C(C)C |
| InChI | InChI=1S/C11H22N2O3/c1-9(2)10(3)8-12-11(16)13(4-6-14)5-7-15/h8-9,14-15H,4-7H2,1-3H3,(H,12,16)/b10-8+ |
| InChIKey | JRHGLNHQZXKJLQ-CSKARUKUSA-N |
| XLogP | 0.54 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |