C13H26N2O2 — CID 108914733
1-[(E)-2,3-dimethylbut-1-enyl]-3-(3-propan-2-yloxypropyl)urea (PubChem CID 108914733) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-[(E)-2,3-dimethylbut-1-enyl]-3-(3-propan-2-yloxypropyl)urea.
| Compound Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(3-propan-2-yloxypropyl)urea |
|---|---|
| PubChem CID | 108914733 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | 1-[(E)-2,3-dimethylbut-1-enyl]-3-(3-propan-2-yloxypropyl)urea |
| SMILES | C/C(=C\NC(=O)NCCCOC(C)C)C(C)C |
| InChI | InChI=1S/C13H26N2O2/c1-10(2)12(5)9-15-13(16)14-7-6-8-17-11(3)4/h9-11H,6-8H2,1-5H3,(H2,14,15,16)/b12-9+ |
| InChIKey | WAOVKSXQSZHDTB-FMIVXFBMSA-N |
| XLogP | 2.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|