C14H21N3O — CID 108915110
1-(6-methyl-2-pyridinyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea (PubChem CID 108915110) has the molecular formula C14H21N3O and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(6-methyl-2-pyridinyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea.
| Compound Name | 1-(6-methyl-2-pyridinyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108915110 |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 1-(6-methyl-2-pyridinyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
| SMILES | C/C(=C\NC(=O)Nc1cccc(C)n1)C(C)(C)C |
| InChI | InChI=1S/C14H21N3O/c1-10(14(3,4)5)9-15-13(18)17-12-8-6-7-11(2)16-12/h6-9H,1-5H3,(H2,15,16,17,18)/b10-9+ |
| InChIKey | VNIJGMVFJWXEII-MDZDMXLPSA-N |
| XLogP | 3.46 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |