C16H24N2O3 — CID 108914916
1-(3,4-dimethoxyphenyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea (PubChem CID 108914916) has the molecular formula C16H24N2O3 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
|---|---|
| PubChem CID | 108914916 |
| Molecular Formula | C16H24N2O3 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(E)-2,3,3-trimethylbut-1-enyl]urea |
| SMILES | COc1ccc(NC(=O)N/C=C(\C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C16H24N2O3/c1-11(16(2,3)4)10-17-15(19)18-12-7-8-13(20-5)14(9-12)21-6/h7-10H,1-6H3,(H2,17,18,19)/b11-10+ |
| InChIKey | AYGRNFHWSQXZEM-ZHACJKMWSA-N |
| XLogP | 3.78 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |