C17H23N3O3S — CID 108915653
4-(benzenesulfonyl)-N-[(E)-2-cyclopropylprop-1-enyl]piperazine-1-carboxamide (PubChem CID 108915653) has the molecular formula C17H23N3O3S and a molecular weight of 349.46 g/mol. Its IUPAC name is 4-(benzenesulfonyl)-N-[(E)-2-cyclopropylprop-1-enyl]piperazine-1-carboxamide.
| Compound Name | 4-(benzenesulfonyl)-N-[(E)-2-cyclopropylprop-1-enyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 108915653 |
| Molecular Formula | C17H23N3O3S |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 4-(benzenesulfonyl)-N-[(E)-2-cyclopropylprop-1-enyl]piperazine-1-carboxamide |
| SMILES | C/C(=C\NC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)C1CC1 |
| InChI | InChI=1S/C17H23N3O3S/c1-14(15-7-8-15)13-18-17(21)19-9-11-20(12-10-19)24(22,23)16-5-3-2-4-6-16/h2-6,13,15H,7-12H2,1H3,(H,18,21)/b14-13+ |
| InChIKey | BJLHOIXJTCZESB-BUHFOSPRSA-N |
| XLogP | 2.02 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |