C16H16N2O2 — CID 108915737
1-[(E)-2-cyclopropylethenyl]-3-(5-hydroxynaphthalen-1-yl)urea (PubChem CID 108915737) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[(E)-2-cyclopropylethenyl]-3-(5-hydroxynaphthalen-1-yl)urea.
| Compound Name | 1-[(E)-2-cyclopropylethenyl]-3-(5-hydroxynaphthalen-1-yl)urea |
|---|---|
| PubChem CID | 108915737 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 1-[(E)-2-cyclopropylethenyl]-3-(5-hydroxynaphthalen-1-yl)urea |
| SMILES | O=C(N/C=C/C1CC1)Nc1cccc2c(O)cccc12 |
| InChI | InChI=1S/C16H16N2O2/c19-15-6-2-3-12-13(15)4-1-5-14(12)18-16(20)17-10-9-11-7-8-11/h1-6,9-11,19H,7-8H2,(H2,17,18,20)/b10-9+ |
| InChIKey | SETYTBFAANRISQ-MDZDMXLPSA-N |
| XLogP | 3.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |