C31H32N4O6 — CID 108917963
tert-butyl N-[2-[2-[[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]methyl]anilino]-2-oxoethyl]carbamate (PubChem CID 108917963) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]methyl]anilino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 108917963 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | tert-butyl N-[2-[2-[[[2-(1,3-dioxoisoindol-2-yl)-3-phenylpropanoyl]amino]methyl]anilino]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)Nc1ccccc1CNC(=O)C(Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C31H32N4O6/c1-31(2,3)41-30(40)33-19-26(36)34-24-16-10-7-13-21(24)18-32-27(37)25(17-20-11-5-4-6-12-20)35-28(38)22-14-8-9-15-23(22)29(35)39/h4-16,25H,17-19H2,1-3H3,(H,32,37)(H,33,40)(H,34,36) |
| InChIKey | LIDBIWZMSDXJJU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|