About diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate
diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate (PubChem CID 10891924) has the molecular formula C14H20O7
and a molecular weight of 300.31 g/mol. Its IUPAC name is diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate |
| PubChem CID | 10891924 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate |
| SMILES | CCOC(=O)C(=CC(=O)[C@H]1COC(C)(C)O1)C(=O)OCC |
| InChI | InChI=1S/C14H20O7/c1-5-18-12(16)9(13(17)19-6-2)7-10(15)11-8-20-14(3,4)21-11/h7,11H,5-6,8H2,1-4H3/t11-/m1/s1 |
| InChIKey | ORSJNNQITCLGHQ-LLVKDONJSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate?
The IUPAC name of diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate (CID 10891924) is diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate.
What is the SMILES notation for diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate?
The canonical SMILES for diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate is CCOC(=O)C(=CC(=O)[C@H]1COC(C)(C)O1)C(=O)OCC.
What is the InChIKey of diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate?
The InChIKey is ORSJNNQITCLGHQ-LLVKDONJSA-N. The full InChI is InChI=1S/C14H20O7/c1-5-18-12(16)9(13(17)19-6-2)7-10(15)11-8-20-14(3,4)21-11/h7,11H,5-6,8H2,1-4H3/t11-/m1/s1.
What are the key properties of diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate?
diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate has a molecular weight of 300.31 g/mol, XLogP of 0.76, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate is sourced from PubChem (CID 10891924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).