C14H20O7 — CID 10891924
diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate (PubChem CID 10891924) has the molecular formula C14H20O7 and a molecular weight of 300.31 g/mol. Its IUPAC name is diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 10891924 |
| Molecular Formula | C14H20O7 |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | diethyl 2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-oxoethylidene]propanedioate |
| SMILES | CCOC(=O)C(=CC(=O)[C@H]1COC(C)(C)O1)C(=O)OCC |
| InChI | InChI=1S/C14H20O7/c1-5-18-12(16)9(13(17)19-6-2)7-10(15)11-8-20-14(3,4)21-11/h7,11H,5-6,8H2,1-4H3/t11-/m1/s1 |
| InChIKey | ORSJNNQITCLGHQ-LLVKDONJSA-N |
| XLogP | 0.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|