C14H24O5 — CID 135037252
(E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-diethoxy-3-methylbut-3-en-2-one (PubChem CID 135037252) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-diethoxy-3-methylbut-3-en-2-one.
| Compound Name | (E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-diethoxy-3-methylbut-3-en-2-one |
|---|---|
| PubChem CID | 135037252 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (E)-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,1-diethoxy-3-methylbut-3-en-2-one |
| SMILES | CCOC(OCC)C(=O)/C(C)=C/[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C14H24O5/c1-6-16-13(17-7-2)12(15)10(3)8-11-9-18-14(4,5)19-11/h8,11,13H,6-7,9H2,1-5H3/b10-8+/t11-/m0/s1 |
| InChIKey | OJUFJXZKWPRGFT-UQSGXBNBSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|