About bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate
bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate (PubChem CID 172907350) has the molecular formula C19H30O8
and a molecular weight of 386.44 g/mol. Its IUPAC name is bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate.
Molecular Properties
| Compound Name | bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate |
| PubChem CID | 172907350 |
| Molecular Formula | C19H30O8 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate |
| SMILES | CCCC=C(C(=O)OCC1COC(C)(C)O1)C(=O)OCC1COC(C)(C)O1 |
| InChI | InChI=1S/C19H30O8/c1-6-7-8-15(16(20)22-9-13-11-24-18(2,3)26-13)17(21)23-10-14-12-25-19(4,5)27-14/h8,13-14H,6-7,9-12H2,1-5H3 |
| InChIKey | MNMJMLFPXBAVNL-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate?
The IUPAC name of bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate (CID 172907350) is bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate.
What is the SMILES notation for bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate?
The canonical SMILES for bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate is CCCC=C(C(=O)OCC1COC(C)(C)O1)C(=O)OCC1COC(C)(C)O1.
What is the InChIKey of bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate?
The InChIKey is MNMJMLFPXBAVNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O8/c1-6-7-8-15(16(20)22-9-13-11-24-18(2,3)26-13)17(21)23-10-14-12-25-19(4,5)27-14/h8,13-14H,6-7,9-12H2,1-5H3.
What are the key properties of bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate?
bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate has a molecular weight of 386.44 g/mol, XLogP of 2.10, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 2-butylidenepropanedioate is sourced from PubChem (CID 172907350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).