C30H31N3O6 — CID 108931586
ethyl [4-[[2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate (PubChem CID 108931586) has the molecular formula C30H31N3O6 and a molecular weight of 529.59 g/mol. Its IUPAC name is ethyl [4-[[2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931586 |
| Molecular Formula | C30H31N3O6 |
| Molecular Weight | 529.59 g/mol |
| Exact Mass | 529.22 |
| IUPAC Name | ethyl [4-[[2-[[5-oxo-1-(1-phenylethyl)pyrrolidine-3-carbonyl]amino]phenyl]methylcarbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)NCc2ccccc2NC(=O)C2CC(=O)N(C(C)c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C30H31N3O6/c1-3-38-30(37)39-25-15-13-22(14-16-25)28(35)31-18-23-11-7-8-12-26(23)32-29(36)24-17-27(34)33(19-24)20(2)21-9-5-4-6-10-21/h4-16,20,24H,3,17-19H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | ZKCJHWKJYJPPLB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|