C25H29N3O6 — CID 108931593
ethyl [4-[[2-[[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate (PubChem CID 108931593) has the molecular formula C25H29N3O6 and a molecular weight of 467.52 g/mol. Its IUPAC name is ethyl [4-[[2-[[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate.
| Compound Name | ethyl [4-[[2-[[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108931593 |
| Molecular Formula | C25H29N3O6 |
| Molecular Weight | 467.52 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | ethyl [4-[[2-[[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]methyl]phenyl]carbamoyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2ccccc2CNC(=O)C2CC(=O)N(C(C)C)C2)cc1 |
| InChI | InChI=1S/C25H29N3O6/c1-4-33-25(32)34-20-11-9-17(10-12-20)24(31)27-21-8-6-5-7-18(21)14-26-23(30)19-13-22(29)28(15-19)16(2)3/h5-12,16,19H,4,13-15H2,1-3H3,(H,26,30)(H,27,31) |
| InChIKey | BIOPCLWIVJCCGS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.52 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|