C25H23ClN2O6 — CID 108931962
[4-[[3-[[(5-chloro-2-methoxybenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate (PubChem CID 108931962) has the molecular formula C25H23ClN2O6 and a molecular weight of 482.92 g/mol. Its IUPAC name is [4-[[3-[[(5-chloro-2-methoxybenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate.
| Compound Name | [4-[[3-[[(5-chloro-2-methoxybenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
|---|---|
| PubChem CID | 108931962 |
| Molecular Formula | C25H23ClN2O6 |
| Molecular Weight | 482.92 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | [4-[[3-[[(5-chloro-2-methoxybenzoyl)amino]methyl]phenyl]carbamoyl]phenyl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)Nc2cccc(CNC(=O)c3cc(Cl)ccc3OC)c2)cc1 |
| InChI | InChI=1S/C25H23ClN2O6/c1-3-33-25(31)34-20-10-7-17(8-11-20)23(29)28-19-6-4-5-16(13-19)15-27-24(30)21-14-18(26)9-12-22(21)32-2/h4-14H,3,15H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | YGPBHXNKXRRULA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.92 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|