C14H18N4O2 — CID 108943957
N'-(2-cyanophenyl)-N-[2-(dimethylamino)ethyl]propanediamide (PubChem CID 108943957) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is N'-(2-cyanophenyl)-N-[2-(dimethylamino)ethyl]propanediamide.
| Compound Name | N'-(2-cyanophenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
|---|---|
| PubChem CID | 108943957 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N'-(2-cyanophenyl)-N-[2-(dimethylamino)ethyl]propanediamide |
| SMILES | CN(C)CCNC(=O)CC(=O)Nc1ccccc1C#N |
| InChI | InChI=1S/C14H18N4O2/c1-18(2)8-7-16-13(19)9-14(20)17-12-6-4-3-5-11(12)10-15/h3-6H,7-9H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | ZZTOULLSHBJKGK-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|