C19H30N2O2 — CID 108962146
2,2-dimethyl-N'-(1-phenylethyl)-N,N-dipropylpropanediamide (PubChem CID 108962146) has the molecular formula C19H30N2O2 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(1-phenylethyl)-N,N-dipropylpropanediamide.
| Compound Name | 2,2-dimethyl-N'-(1-phenylethyl)-N,N-dipropylpropanediamide |
|---|---|
| PubChem CID | 108962146 |
| Molecular Formula | C19H30N2O2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 2,2-dimethyl-N'-(1-phenylethyl)-N,N-dipropylpropanediamide |
| SMILES | CCCN(CCC)C(=O)C(C)(C)C(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C19H30N2O2/c1-6-13-21(14-7-2)18(23)19(4,5)17(22)20-15(3)16-11-9-8-10-12-16/h8-12,15H,6-7,13-14H2,1-5H3,(H,20,22) |
| InChIKey | HVGZLMPENIRORM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|