C18H25FN2O2 — CID 108962425
N-[(2-fluorophenyl)methyl]-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide (PubChem CID 108962425) has the molecular formula C18H25FN2O2 and a molecular weight of 320.41 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 108962425 |
| Molecular Formula | C18H25FN2O2 |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-2,2-dimethyl-3-(3-methylpiperidin-1-yl)-3-oxopropanamide |
| SMILES | CC1CCCN(C(=O)C(C)(C)C(=O)NCc2ccccc2F)C1 |
| InChI | InChI=1S/C18H25FN2O2/c1-13-7-6-10-21(12-13)17(23)18(2,3)16(22)20-11-14-8-4-5-9-15(14)19/h4-5,8-9,13H,6-7,10-12H2,1-3H3,(H,20,22) |
| InChIKey | GRXKXPYTGPIKBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|