C18H21FN4O — CID 109348047
[6-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(3-methylpiperidin-1-yl)methanone (PubChem CID 109348047) has the molecular formula C18H21FN4O and a molecular weight of 328.39 g/mol. Its IUPAC name is [6-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(3-methylpiperidin-1-yl)methanone.
| Compound Name | [6-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(3-methylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 109348047 |
| Molecular Formula | C18H21FN4O |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | [6-[(2-fluorophenyl)methylamino]pyrimidin-4-yl]-(3-methylpiperidin-1-yl)methanone |
| SMILES | CC1CCCN(C(=O)c2cc(NCc3ccccc3F)ncn2)C1 |
| InChI | InChI=1S/C18H21FN4O/c1-13-5-4-8-23(11-13)18(24)16-9-17(22-12-21-16)20-10-14-6-2-3-7-15(14)19/h2-3,6-7,9,12-13H,4-5,8,10-11H2,1H3,(H,20,21,22) |
| InChIKey | CCQHDCDAIJJIMV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |