C20H23FN2O2 — CID 108964178
N-[2-(4-fluorophenyl)ethyl]-2,2-dimethyl-N'-(3-methylphenyl)propanediamide (PubChem CID 108964178) has the molecular formula C20H23FN2O2 and a molecular weight of 342.41 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)ethyl]-2,2-dimethyl-N'-(3-methylphenyl)propanediamide.
| Compound Name | N-[2-(4-fluorophenyl)ethyl]-2,2-dimethyl-N'-(3-methylphenyl)propanediamide |
|---|---|
| PubChem CID | 108964178 |
| Molecular Formula | C20H23FN2O2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-[2-(4-fluorophenyl)ethyl]-2,2-dimethyl-N'-(3-methylphenyl)propanediamide |
| SMILES | Cc1cccc(NC(=O)C(C)(C)C(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C20H23FN2O2/c1-14-5-4-6-17(13-14)23-19(25)20(2,3)18(24)22-12-11-15-7-9-16(21)10-8-15/h4-10,13H,11-12H2,1-3H3,(H,22,24)(H,23,25) |
| InChIKey | RXWQBWPYQNTTGF-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|