C19H19F3N2O2 — CID 108964253
N-(3,4-difluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108964253) has the molecular formula C19H19F3N2O2 and a molecular weight of 364.37 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(3,4-difluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108964253 |
| Molecular Formula | C19H19F3N2O2 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | N-(3,4-difluorophenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)NCCc1ccc(F)cc1)C(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H19F3N2O2/c1-19(2,18(26)24-14-7-8-15(21)16(22)11-14)17(25)23-10-9-12-3-5-13(20)6-4-12/h3-8,11H,9-10H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | QCCPDBQMBZKPHZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|