C21H23FN2O3 — CID 108964225
N-(3-acetylphenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide (PubChem CID 108964225) has the molecular formula C21H23FN2O3 and a molecular weight of 370.42 g/mol. Its IUPAC name is N-(3-acetylphenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide.
| Compound Name | N-(3-acetylphenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108964225 |
| Molecular Formula | C21H23FN2O3 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N-(3-acetylphenyl)-N'-[2-(4-fluorophenyl)ethyl]-2,2-dimethylpropanediamide |
| SMILES | CC(=O)c1cccc(NC(=O)C(C)(C)C(=O)NCCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C21H23FN2O3/c1-14(25)16-5-4-6-18(13-16)24-20(27)21(2,3)19(26)23-12-11-15-7-9-17(22)10-8-15/h4-10,13H,11-12H2,1-3H3,(H,23,26)(H,24,27) |
| InChIKey | KWNZDKJFTVHSFW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|